CAS 1332530-36-5 is the registry number for N-[(5-Methyl-1,3-thiazol-2-yl)methyl]cyclopropanamine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
N-[(5-methyl-1,3-thiazol-2-yl)methyl]cyclopropanamine;dihydrochloride (CAS 1332530-36-5) is a chemical compound with the molecular formula C8H14Cl2N2S and a molecular weight of 241.18 g/mol. IUPAC name: N-[(5-methyl-1,3-thiazol-2-yl)methyl]cyclopropanamine;dihydrochloride. InChIKey: LMGMBVKLBDSCJS-UHFFFAOYSA-N.
| Molecular formula | C8H14Cl2N2S |
|---|---|
| Molecular weight | 241.18 g/mol |
| IUPAC name | N-[(5-methyl-1,3-thiazol-2-yl)methyl]cyclopropanamine;dihydrochloride |
| InChIKey | LMGMBVKLBDSCJS-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(S1)CNC2CC2.Cl.Cl |
Computed by PubChem (NCBI)