Products 2138084-26-9
CAS 2138084-26-9 is the registry number for 2-Ethyl-4H,5H,6H,7H-(1,3)thiazolo(5,4-c)pyridine dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-ethyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine;dihydrochloride (CAS 2138084-26-9) is a chemical compound with the molecular formula C8H14Cl2N2S and a molecular weight of 241.18 g/mol. IUPAC name: 2-ethyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine;dihydrochloride. InChIKey: FWKLCZDSNRWXDK-UHFFFAOYSA-N.
| Molecular formula | C8H14Cl2N2S |
|---|---|
| Molecular weight | 241.18 g/mol |
| IUPAC name | 2-ethyl-4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridine;dihydrochloride |
| InChIKey | FWKLCZDSNRWXDK-UHFFFAOYSA-N |
| SMILES | CCC1=NC2=C(S1)CNCC2.Cl.Cl |
Computed by PubChem (NCBI)