CAS 2567504-48-5 is the registry number for 2-Methyl-5,6,7,8-tetrahydro-4H-thiazolo(4,5-d)azepine dihydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
2-methyl-5,6,7,8-tetrahydro-4H-[1,3]thiazolo[4,5-d]azepine;dihydrochloride (CAS 2567504-48-5) is a chemical compound with the molecular formula C8H14Cl2N2S and a molecular weight of 241.18 g/mol. IUPAC name: 2-methyl-5,6,7,8-tetrahydro-4H-[1,3]thiazolo[4,5-d]azepine;dihydrochloride. InChIKey: MHORIOSSGQJTED-UHFFFAOYSA-N.
| Molecular formula | C8H14Cl2N2S |
|---|---|
| Molecular weight | 241.18 g/mol |
| IUPAC name | 2-methyl-5,6,7,8-tetrahydro-4H-[1,3]thiazolo[4,5-d]azepine;dihydrochloride |
| InChIKey | MHORIOSSGQJTED-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(S1)CCNCC2.Cl.Cl |
Computed by PubChem (NCBI)