Products 1461708-28-0
CAS 1461708-28-0 appears in our catalog under these names: 4-Cyclopentyl-1,3-thiazol-5-amine dihydrochloride, 95%, 4-Cyclopentyl-1,3-thiazol-5-amine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-cyclopentyl-1,3-thiazol-5-amine;dihydrochloride (CAS 1461708-28-0) is a chemical compound with the molecular formula C8H14Cl2N2S and a molecular weight of 241.18 g/mol. IUPAC name: 4-cyclopentyl-1,3-thiazol-5-amine;dihydrochloride. InChIKey: RYYUZSKYWRUFMA-UHFFFAOYSA-N.
| Molecular formula | C8H14Cl2N2S |
|---|---|
| Molecular weight | 241.18 g/mol |
| IUPAC name | 4-cyclopentyl-1,3-thiazol-5-amine;dihydrochloride |
| InChIKey | RYYUZSKYWRUFMA-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)C2=C(SC=N2)N.Cl.Cl |
Computed by PubChem (NCBI)