Products 1351590-47-0
CAS 1351590-47-0 appears in our catalog under these names: 2-(2-Thienyl)piperazine dihydrochloride, 95%, 2-(Thiophen-2-yl)piperazine dihydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 250mg, 1g, 2,5g.
2-thiophen-2-ylpiperazine;dihydrochloride (CAS 1351590-47-0) is a chemical compound with the molecular formula C8H14Cl2N2S and a molecular weight of 241.18 g/mol. IUPAC name: 2-thiophen-2-ylpiperazine;dihydrochloride. InChIKey: GKNVKIRDGQBRGQ-UHFFFAOYSA-N.
| Molecular formula | C8H14Cl2N2S |
|---|---|
| Molecular weight | 241.18 g/mol |
| IUPAC name | 2-thiophen-2-ylpiperazine;dihydrochloride |
| InChIKey | GKNVKIRDGQBRGQ-UHFFFAOYSA-N |
| SMILES | C1CNC(CN1)C2=CC=CS2.Cl.Cl |
Computed by PubChem (NCBI)