CAS 1332529-49-3 is the registry number for 5-Thiazolemethanamine, N-cyclopropyl-4-methyl-, dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
N-[(4-methyl-1,3-thiazol-5-yl)methyl]cyclopropanamine;dihydrochloride (CAS 1332529-49-3) is a chemical compound with the molecular formula C8H14Cl2N2S and a molecular weight of 241.18 g/mol. IUPAC name: N-[(4-methyl-1,3-thiazol-5-yl)methyl]cyclopropanamine;dihydrochloride. InChIKey: IYKOCPPZEROMTF-UHFFFAOYSA-N.
| Molecular formula | C8H14Cl2N2S |
|---|---|
| Molecular weight | 241.18 g/mol |
| IUPAC name | N-[(4-methyl-1,3-thiazol-5-yl)methyl]cyclopropanamine;dihydrochloride |
| InChIKey | IYKOCPPZEROMTF-UHFFFAOYSA-N |
| SMILES | CC1=C(SC=N1)CNC2CC2.Cl.Cl |
Computed by PubChem (NCBI)