Products 1241675-84-2
CAS 1241675-84-2 is the registry number for 3-(2,4-Difluorophenoxy)azetidine hydrochloride, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 5g, 10g.
3-(2,4-difluorophenoxy)azetidine;hydrochloride (CAS 1241675-84-2) is a chemical compound with the molecular formula C9H10ClF2NO and a molecular weight of 221.63 g/mol. IUPAC name: 3-(2,4-difluorophenoxy)azetidine;hydrochloride. InChIKey: DZGOPXZJIMJNDN-UHFFFAOYSA-N.
| Molecular formula | C9H10ClF2NO |
|---|---|
| Molecular weight | 221.63 g/mol |
| IUPAC name | 3-(2,4-difluorophenoxy)azetidine;hydrochloride |
| InChIKey | DZGOPXZJIMJNDN-UHFFFAOYSA-N |
| SMILES | C1C(CN1)OC2=C(C=C(C=C2)F)F.Cl |
Computed by PubChem (NCBI)