CAS 1242267-84-0 is the registry number for 4-(Trifluoromethyl)-1h,2h,3h-pyrazolo[3,4-b]pyridin-3-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-(trifluoromethyl)-1,2-dihydropyrazolo[3,4-b]pyridin-3-one (CAS 1242267-84-0) is a chemical compound with the molecular formula C7H4F3N3O and a molecular weight of 203.12 g/mol. IUPAC name: 4-(trifluoromethyl)-1,2-dihydropyrazolo[3,4-b]pyridin-3-one. InChIKey: CDDDQKFLGSXJBO-UHFFFAOYSA-N.
| Molecular formula | C7H4F3N3O |
|---|---|
| Molecular weight | 203.12 g/mol |
| IUPAC name | 4-(trifluoromethyl)-1,2-dihydropyrazolo[3,4-b]pyridin-3-one |
| InChIKey | CDDDQKFLGSXJBO-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C(=C1C(F)(F)F)C(=O)NN2 |
Computed by PubChem (NCBI)