Products 951753-85-8
CAS 951753-85-8 is the registry number for 5-Amino-6-oxo-3-(trifluoromethyl)-1,6-dihydropyridine-2-carbonitrile, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
5-amino-6-oxo-3-(trifluoromethyl)-1H-pyridine-2-carbonitrile (CAS 951753-85-8) is a chemical compound with the molecular formula C7H4F3N3O and a molecular weight of 203.12 g/mol. IUPAC name: 5-amino-6-oxo-3-(trifluoromethyl)-1H-pyridine-2-carbonitrile. InChIKey: WTCGUYCXFMBCJI-UHFFFAOYSA-N.
| Molecular formula | C7H4F3N3O |
|---|---|
| Molecular weight | 203.12 g/mol |
| IUPAC name | 5-amino-6-oxo-3-(trifluoromethyl)-1H-pyridine-2-carbonitrile |
| InChIKey | WTCGUYCXFMBCJI-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC(=C1C(F)(F)F)C#N)N |
Computed by PubChem (NCBI)