CAS 2126740-48-3 is the registry number for 6-(Trifluoromethyl)oxazolo[4,5-c]pyridin-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(trifluoromethyl)-[1,3]oxazolo[4,5-c]pyridin-2-amine (CAS 2126740-48-3) is a chemical compound with the molecular formula C7H4F3N3O and a molecular weight of 203.12 g/mol. IUPAC name: 6-(trifluoromethyl)-[1,3]oxazolo[4,5-c]pyridin-2-amine. InChIKey: IRTGBMPYJNTRPV-UHFFFAOYSA-N.
| Molecular formula | C7H4F3N3O |
|---|---|
| Molecular weight | 203.12 g/mol |
| IUPAC name | 6-(trifluoromethyl)-[1,3]oxazolo[4,5-c]pyridin-2-amine |
| InChIKey | IRTGBMPYJNTRPV-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CN=C1C(F)(F)F)N=C(O2)N |
Computed by PubChem (NCBI)