Products 2803704-92-7
CAS 2803704-92-7 is the registry number for 5-(Trifluoromethyl)imidazo[1,5-b]pyridazin-3-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(trifluoromethyl)imidazo[1,5-b]pyridazin-3-ol (CAS 2803704-92-7) is a chemical compound with the molecular formula C7H4F3N3O and a molecular weight of 203.12 g/mol. IUPAC name: 5-(trifluoromethyl)imidazo[1,5-b]pyridazin-3-ol. InChIKey: GQNWZAGVOWLJSD-UHFFFAOYSA-N.
| Molecular formula | C7H4F3N3O |
|---|---|
| Molecular weight | 203.12 g/mol |
| IUPAC name | 5-(trifluoromethyl)imidazo[1,5-b]pyridazin-3-ol |
| InChIKey | GQNWZAGVOWLJSD-UHFFFAOYSA-N |
| SMILES | C1=C(C=NN2C1=C(N=C2)C(F)(F)F)O |
Computed by PubChem (NCBI)