CAS 1242515-52-1 is the registry number for 6-(trifluoromethyl)isoxazolo[5,4-b]pyridin-3-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(trifluoromethyl)-[1,2]oxazolo[5,4-b]pyridin-3-amine (CAS 1242515-52-1) is a chemical compound with the molecular formula C7H4F3N3O and a molecular weight of 203.12 g/mol. IUPAC name: 6-(trifluoromethyl)-[1,2]oxazolo[5,4-b]pyridin-3-amine. InChIKey: JHDNLAITWWDCCR-UHFFFAOYSA-N.
| Molecular formula | C7H4F3N3O |
|---|---|
| Molecular weight | 203.12 g/mol |
| IUPAC name | 6-(trifluoromethyl)-[1,2]oxazolo[5,4-b]pyridin-3-amine |
| InChIKey | JHDNLAITWWDCCR-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1C(=NO2)N)C(F)(F)F |
Computed by PubChem (NCBI)