CAS 425702-95-0 is the registry number for 6-(Trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3(2h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-(trifluoromethyl)-2H-[1,2,4]triazolo[4,3-a]pyridin-3-one (CAS 425702-95-0) is a chemical compound with the molecular formula C7H4F3N3O and a molecular weight of 203.12 g/mol. IUPAC name: 6-(trifluoromethyl)-2H-[1,2,4]triazolo[4,3-a]pyridin-3-one. InChIKey: LQMGJFYJBYMLCF-UHFFFAOYSA-N.
| Molecular formula | C7H4F3N3O |
|---|---|
| Molecular weight | 203.12 g/mol |
| IUPAC name | 6-(trifluoromethyl)-2H-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| InChIKey | LQMGJFYJBYMLCF-UHFFFAOYSA-N |
| SMILES | C1=CC2=NNC(=O)N2C=C1C(F)(F)F |
Computed by PubChem (NCBI)