Products 1820718-45-3
CAS 1820718-45-3 is the registry number for trifluoro-1,3-benzoxazole-2,4-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5,6,7-trifluoro-1,3-benzoxazole-2,4-diamine (CAS 1820718-45-3) is a chemical compound with the molecular formula C7H4F3N3O and a molecular weight of 203.12 g/mol. IUPAC name: 5,6,7-trifluoro-1,3-benzoxazole-2,4-diamine. InChIKey: DFUJUEPORUGOOO-UHFFFAOYSA-N.
| Molecular formula | C7H4F3N3O |
|---|---|
| Molecular weight | 203.12 g/mol |
| IUPAC name | 5,6,7-trifluoro-1,3-benzoxazole-2,4-diamine |
| InChIKey | DFUJUEPORUGOOO-UHFFFAOYSA-N |
| SMILES | C1(=C2C(=C(C(=C1F)F)F)OC(=N2)N)N |
Computed by PubChem (NCBI)