CAS 94847-20-8 appears in our catalog under these names: 4-(Trifluoromethyl)-1H-pyrazolo(3,4-b)pyridin-6-ol, 95%, 4-(Trifluoromethyl)-1H-pyrazolo(3,4-b)pyridin-6-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-(trifluoromethyl)-1,7-dihydropyrazolo[5,4-b]pyridin-6-one (CAS 94847-20-8) is a chemical compound with the molecular formula C7H4F3N3O and a molecular weight of 203.12 g/mol. IUPAC name: 4-(trifluoromethyl)-1,7-dihydropyrazolo[5,4-b]pyridin-6-one. InChIKey: HPMYGOVTLTVSLD-UHFFFAOYSA-N.
| Molecular formula | C7H4F3N3O |
|---|---|
| Molecular weight | 203.12 g/mol |
| IUPAC name | 4-(trifluoromethyl)-1,7-dihydropyrazolo[5,4-b]pyridin-6-one |
| InChIKey | HPMYGOVTLTVSLD-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(NC1=O)NN=C2)C(F)(F)F |
Computed by PubChem (NCBI)