CAS 124276-87-5 appears in our catalog under these names: 1-(2-Bromophenyl)cyclopropanecarboxylic acid, 98%, 1–(2–Bromophenyl)cyclopropanecarboxylic acid, 1-(2-Bromophenyl)cyclopropanecarboxylic acid, 1-(2-Bromophenyl)cyclopropanecarboxylic acid 97%, 1-(2-Bromophenyl)cyclopropanecarboxylic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 25g, 10g, 5g, 250mg, 100mg.
1-(2-bromophenyl)cyclopropane-1-carboxylic acid (CAS 124276-87-5) is a chemical compound with the molecular formula C10H9BrO2 and a molecular weight of 241.08 g/mol. IUPAC name: 1-(2-bromophenyl)cyclopropane-1-carboxylic acid. InChIKey: BJFFZQJYJMQPHY-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO2 |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 1-(2-bromophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | BJFFZQJYJMQPHY-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC=CC=C2Br)C(=O)O |
Computed by PubChem (NCBI)