CAS 124276-95-5 appears in our catalog under these names: 1–(3–bromophenyl)cyclopropane–1–carboxylic acid, 1-(3-Bromophenyl)cyclopropane-1-carboxylic acid, 1-(3-Bromophenyl)cyclopropanecarboxylic acid, 96%, 96%, 1-(3-Bromophenyl)cyclopropanecarboxylic acid, 96%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 10g, 100g, 250mg, 500mg.
1-(3-bromophenyl)cyclopropane-1-carboxylic acid (CAS 124276-95-5) is a chemical compound with the molecular formula C10H9BrO2 and a molecular weight of 241.08 g/mol. IUPAC name: 1-(3-bromophenyl)cyclopropane-1-carboxylic acid. InChIKey: MYDCJGVBYNDHIC-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO2 |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 1-(3-bromophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | MYDCJGVBYNDHIC-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC(=CC=C2)Br)C(=O)O |
Computed by PubChem (NCBI)