Products 1245515-61-0
CAS 1245515-61-0 is the registry number for Methyl 2-(bromomethyl)-4,5-difluorobenzoate, 97%. Offered by: Ambeed, BLDpharm, Chemat. Available pack sizes: 250mg, 1g, 100mg.
Methyl 2-(bromomethyl)-4,5-difluorobenzoate (CAS 1245515-61-0) is a chemical compound with the molecular formula C9H7BrF2O2 and a molecular weight of 265.05 g/mol. IUPAC name: methyl 2-(bromomethyl)-4,5-difluorobenzoate. InChIKey: BJAZHJGTPBMOCI-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O2 |
|---|---|
| Molecular weight | 265.05 g/mol |
| IUPAC name | methyl 2-(bromomethyl)-4,5-difluorobenzoate |
| InChIKey | BJAZHJGTPBMOCI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1CBr)F)F |
Computed by PubChem (NCBI)