CAS 1245622-86-9 is the registry number for 2-Amino-2-(2,3-difluorophenyl)ethanol hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-amino-2-(2,3-difluorophenyl)ethanol;hydrochloride (CAS 1245622-86-9) is a chemical compound with the molecular formula C8H10ClF2NO and a molecular weight of 209.62 g/mol. IUPAC name: 2-amino-2-(2,3-difluorophenyl)ethanol;hydrochloride. InChIKey: XREOCOTWOUFHDJ-UHFFFAOYSA-N.
| Molecular formula | C8H10ClF2NO |
|---|---|
| Molecular weight | 209.62 g/mol |
| IUPAC name | 2-amino-2-(2,3-difluorophenyl)ethanol;hydrochloride |
| InChIKey | XREOCOTWOUFHDJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)F)C(CO)N.Cl |
Computed by PubChem (NCBI)