Products 2989051-23-0
CAS 2989051-23-0 appears in our catalog under these names: (R)-2-Amino-2-(2,3-difluorophenyl)ethan-1-ol (hydrochloride), 95%, 95%, (R)-2-Amino-2-(2,3-difluorophenyl)ethan-1-ol (hydrochloride), 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(2R)-2-amino-2-(2,3-difluorophenyl)ethanol;hydrochloride (CAS 2989051-23-0) is a chemical compound with the molecular formula C8H10ClF2NO and a molecular weight of 209.62 g/mol. IUPAC name: (2R)-2-amino-2-(2,3-difluorophenyl)ethanol;hydrochloride. InChIKey: XREOCOTWOUFHDJ-FJXQXJEOSA-N.
| Molecular formula | C8H10ClF2NO |
|---|---|
| Molecular weight | 209.62 g/mol |
| IUPAC name | (2R)-2-amino-2-(2,3-difluorophenyl)ethanol;hydrochloride |
| InChIKey | XREOCOTWOUFHDJ-FJXQXJEOSA-N |
| SMILES | C1=CC(=C(C(=C1)F)F)[C@H](CO)N.Cl |
Computed by PubChem (NCBI)