CAS 124627-69-6 is the registry number for 6–(2–chloroethoxy)benzofuran–3(2H)–one. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
6-(2-chloroethoxy)-1-benzofuran-3-one (CAS 124627-69-6) is a chemical compound with the molecular formula C10H9ClO3 and a molecular weight of 212.63 g/mol. IUPAC name: 6-(2-chloroethoxy)-1-benzofuran-3-one. InChIKey: BUZFKXULXBOQRH-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO3 |
|---|---|
| Molecular weight | 212.63 g/mol |
| IUPAC name | 6-(2-chloroethoxy)-1-benzofuran-3-one |
| InChIKey | BUZFKXULXBOQRH-UHFFFAOYSA-N |
| SMILES | C1C(=O)C2=C(O1)C=C(C=C2)OCCCl |
Computed by PubChem (NCBI)