CAS 1246819-50-0 appears in our catalog under these names: Febuxostat-d9, Febuxostat D9, Febuxostat-d9, >95% (HPLC), Febuxostat-d9 (2-methylpropoxy-d9), 99 atom % D, min 98% Chemical Purity, Febuxostat-d9, 98.70%. Offered by: Chemat Brand, TRC, CDN, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 0,01g, 0,005g, 1 mg, 10 mg, 5 mg.
2-[3-cyano-4-[1,1,2,3,3,3-hexadeuterio-2-(trideuteriomethyl)propoxy]phenyl]-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 1246819-50-0) is a chemical compound with the molecular formula C16H16N2O3S and a molecular weight of 325.4 g/mol. IUPAC name: 2-[3-cyano-4-[1,1,2,3,3,3-hexadeuterio-2-(trideuteriomethyl)propoxy]phenyl]-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: BQSJTQLCZDPROO-KIROAFHOSA-N.
| Molecular formula | C16H16N2O3S |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | 2-[3-cyano-4-[1,1,2,3,3,3-hexadeuterio-2-(trideuteriomethyl)propoxy]phenyl]-4-methyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | BQSJTQLCZDPROO-KIROAFHOSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])C([2H])([2H])OC1=C(C=C(C=C1)C2=NC(=C(S2)C(=O)O)C)C#N |
Computed by PubChem (NCBI)