Products 2173100-96-2
CAS 2173100-96-2 is the registry number for 1-(5-Ethyl-4-phenyl-1,3-thiazol-2-yl)-5-oxopyrrolidine-3-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
1-(5-ethyl-4-phenyl-1,3-thiazol-2-yl)-5-oxopyrrolidine-3-carboxylic acid (CAS 2173100-96-2) is a chemical compound with the molecular formula C16H16N2O3S and a molecular weight of 316.4 g/mol. IUPAC name: 1-(5-ethyl-4-phenyl-1,3-thiazol-2-yl)-5-oxopyrrolidine-3-carboxylic acid. InChIKey: SUOIEJSXXUWLKS-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O3S |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | 1-(5-ethyl-4-phenyl-1,3-thiazol-2-yl)-5-oxopyrrolidine-3-carboxylic acid |
| InChIKey | SUOIEJSXXUWLKS-UHFFFAOYSA-N |
| SMILES | CCC1=C(N=C(S1)N2CC(CC2=O)C(=O)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)