CAS 349428-05-3 is the registry number for indolinyl-N-(4-tolylsulfonyl)formamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-(4-methylphenyl)sulfonyl-2,3-dihydroindole-1-carboxamide (CAS 349428-05-3) is a chemical compound with the molecular formula C16H16N2O3S and a molecular weight of 316.4 g/mol. IUPAC name: N-(4-methylphenyl)sulfonyl-2,3-dihydroindole-1-carboxamide. InChIKey: OMQABHXBGVHEQC-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O3S |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | N-(4-methylphenyl)sulfonyl-2,3-dihydroindole-1-carboxamide |
| InChIKey | OMQABHXBGVHEQC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC(=O)N2CCC3=CC=CC=C32 |
Computed by PubChem (NCBI)