CAS 312587-72-7 is the registry number for N-(4-(indolinylsulfonyl)phenyl)ethanamide. Offered by: Biosynth. Available pack sizes: 1g, 2g, 5g, 25g, 10g.
N-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]acetamide (CAS 312587-72-7) is a chemical compound with the molecular formula C16H16N2O3S and a molecular weight of 316.4 g/mol. IUPAC name: N-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]acetamide. InChIKey: KPJGRYOLZDRQKR-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O3S |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | N-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]acetamide |
| InChIKey | KPJGRYOLZDRQKR-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)S(=O)(=O)N2CCC3=CC=CC=C32 |
Computed by PubChem (NCBI)