CAS 1331902-93-2 appears in our catalog under these names: Tirofiban Impurity 70, S-Phenyl-L-cysteine-N-(3-aminophenyl)amide. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 500mg.
(2R)-2-[(3-aminobenzoyl)amino]-3-phenylsulfanylpropanoic acid (CAS 1331902-93-2) is a chemical compound with the molecular formula C16H16N2O3S and a molecular weight of 316.4 g/mol. IUPAC name: (2R)-2-[(3-aminobenzoyl)amino]-3-phenylsulfanylpropanoic acid. InChIKey: LQJBCLLRNLAOGW-AWEZNQCLSA-N.
| Molecular formula | C16H16N2O3S |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | (2R)-2-[(3-aminobenzoyl)amino]-3-phenylsulfanylpropanoic acid |
| InChIKey | LQJBCLLRNLAOGW-AWEZNQCLSA-N |
| SMILES | C1=CC=C(C=C1)SC[C@@H](C(=O)O)NC(=O)C2=CC(=CC=C2)N |
Computed by PubChem (NCBI)