CAS 2418591-43-0 is the registry number for Febuxostat Impurity 32. Offered by: Chemat Brand. Available pack sizes: on request.
2-[3-cyano-4-[(2-methylpropan-2-yl)oxy]phenyl]-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 2418591-43-0) is a chemical compound with the molecular formula C16H16N2O3S and a molecular weight of 316.4 g/mol. IUPAC name: 2-[3-cyano-4-[(2-methylpropan-2-yl)oxy]phenyl]-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: QAVRUYZRQUVAKL-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O3S |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | 2-[3-cyano-4-[(2-methylpropan-2-yl)oxy]phenyl]-4-methyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | QAVRUYZRQUVAKL-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CC(=C(C=C2)OC(C)(C)C)C#N)C(=O)O |
Computed by PubChem (NCBI)