CAS 1335202-59-9 appears in our catalog under these names: Febuxostat Impurity 63, Febuxostat Impurity U, Febuxostat 2-Butyl Isomer, >95% (HPLC), Febuxostat Sec-butoxy acid, Febuxostat sec-butoxy acid 98%. Offered by: Chemat Brand, TRC, Biosynth, Ambeed, Sigma-Aldrich. Available pack sizes: on request, 100mg, 10mg, 1g, 250mg, 25MG, 10mM/1mL, 1 mg.
2-(4-butan-2-yloxy-3-cyanophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 1335202-59-9) is a chemical compound with the molecular formula C16H16N2O3S and a molecular weight of 316.4 g/mol. IUPAC name: 2-(4-butan-2-yloxy-3-cyanophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: HNNODDVYKUBOBQ-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O3S |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | 2-(4-butan-2-yloxy-3-cyanophenyl)-4-methyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | HNNODDVYKUBOBQ-UHFFFAOYSA-N |
| SMILES | CCC(C)OC1=C(C=C(C=C1)C2=NC(=C(S2)C(=O)O)C)C#N |
Computed by PubChem (NCBI)