Products 1285539-74-3
CAS 1285539-74-3 appears in our catalog under these names: Febuxostat-d7, Febuxostat-d7, >95% (HPLC), Febuxostat-d7, 99.06%. Offered by: Chemat Brand, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 5mg, 25mg, 50mg, 10 mg, 1 mg.
2-[3-cyano-4-[2,3,3,3-tetradeuterio-2-(trideuteriomethyl)propoxy]phenyl]-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 1285539-74-3) is a chemical compound with the molecular formula C16H16N2O3S and a molecular weight of 323.4 g/mol. IUPAC name: 2-[3-cyano-4-[2,3,3,3-tetradeuterio-2-(trideuteriomethyl)propoxy]phenyl]-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: BQSJTQLCZDPROO-SCENNGIESA-N.
| Molecular formula | C16H16N2O3S |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | 2-[3-cyano-4-[2,3,3,3-tetradeuterio-2-(trideuteriomethyl)propoxy]phenyl]-4-methyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | BQSJTQLCZDPROO-SCENNGIESA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(COC1=C(C=C(C=C1)C2=NC(=C(S2)C(=O)O)C)C#N)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)