CAS 1247532-79-1 appears in our catalog under these names: 1-(3,5-Dichloropyridin-2-yl)-1H-pyrazol-4-amine, 95%, 1-(3,5-Dichloropyridin-2-yl)-1H-pyrazol-4-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-(3,5-dichloro-2-pyridinyl)pyrazol-4-amine (CAS 1247532-79-1) is a chemical compound with the molecular formula C8H6Cl2N4 and a molecular weight of 229.06 g/mol. IUPAC name: 1-(3,5-dichloro-2-pyridinyl)pyrazol-4-amine. InChIKey: SPTWIADVPOGCGX-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2N4 |
|---|---|
| Molecular weight | 229.06 g/mol |
| IUPAC name | 1-(3,5-dichloro-2-pyridinyl)pyrazol-4-amine |
| InChIKey | SPTWIADVPOGCGX-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Cl)N2C=C(C=N2)N)Cl |
Computed by PubChem (NCBI)