Products 1630906-84-1
CAS 1630906-84-1 is the registry number for 5,7-Dichloro-2-cyclopropyl-2h-pyrazolo[4,3-d]pyrimidine, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg, 100mg.
5,7-dichloro-2-cyclopropylpyrazolo[4,3-d]pyrimidine (CAS 1630906-84-1) is a chemical compound with the molecular formula C8H6Cl2N4 and a molecular weight of 229.06 g/mol. IUPAC name: 5,7-dichloro-2-cyclopropylpyrazolo[4,3-d]pyrimidine. InChIKey: DHOPBSQPTHVAKG-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2N4 |
|---|---|
| Molecular weight | 229.06 g/mol |
| IUPAC name | 5,7-dichloro-2-cyclopropylpyrazolo[4,3-d]pyrimidine |
| InChIKey | DHOPBSQPTHVAKG-UHFFFAOYSA-N |
| SMILES | C1CC1N2C=C3C(=N2)C(=NC(=N3)Cl)Cl |
Computed by PubChem (NCBI)