CAS 91895-34-0 appears in our catalog under these names: 2,6-Dichloro-3-hydrazinylquinoxaline, 95%, 2,6-Dichloro-3-hydrazinoquinoxaline. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
(3,7-dichloroquinoxalin-2-yl)hydrazine (CAS 91895-34-0) is a chemical compound with the molecular formula C8H6Cl2N4 and a molecular weight of 229.06 g/mol. IUPAC name: (3,7-dichloroquinoxalin-2-yl)hydrazine. InChIKey: UMIBNTAMBAHQPV-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2N4 |
|---|---|
| Molecular weight | 229.06 g/mol |
| IUPAC name | (3,7-dichloroquinoxalin-2-yl)hydrazine |
| InChIKey | UMIBNTAMBAHQPV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)N=C(C(=N2)Cl)NN |
Computed by PubChem (NCBI)