CAS 304883-87-2 is the registry number for 3-(3,5-Dichlorophenyl)-1H-1,2,4-triazol-5-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(3,5-dichlorophenyl)-1H-1,2,4-triazol-3-amine (CAS 304883-87-2) is a chemical compound with the molecular formula C8H6Cl2N4 and a molecular weight of 229.06 g/mol. IUPAC name: 5-(3,5-dichlorophenyl)-1H-1,2,4-triazol-3-amine. InChIKey: MUHCGJWMGILNAJ-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2N4 |
|---|---|
| Molecular weight | 229.06 g/mol |
| IUPAC name | 5-(3,5-dichlorophenyl)-1H-1,2,4-triazol-3-amine |
| InChIKey | MUHCGJWMGILNAJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)C2=NC(=NN2)N |
Computed by PubChem (NCBI)