Products 1553952-53-6
CAS 1553952-53-6 is the registry number for 3,6-Dichloro-4-(1-methyl-1H-pyrazol-5-yl)pyridazine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3,6-dichloro-4-(2-methylpyrazol-3-yl)pyridazine (CAS 1553952-53-6) is a chemical compound with the molecular formula C8H6Cl2N4 and a molecular weight of 229.06 g/mol. IUPAC name: 3,6-dichloro-4-(2-methylpyrazol-3-yl)pyridazine. InChIKey: LDQYCYPFFKTNIR-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2N4 |
|---|---|
| Molecular weight | 229.06 g/mol |
| IUPAC name | 3,6-dichloro-4-(2-methylpyrazol-3-yl)pyridazine |
| InChIKey | LDQYCYPFFKTNIR-UHFFFAOYSA-N |
| SMILES | CN1C(=CC=N1)C2=CC(=NN=C2Cl)Cl |
Computed by PubChem (NCBI)