Products 1628460-33-2
CAS 1628460-33-2 is the registry number for 4,6-Dichloro-1-cyclopropyl-1H-pyrazolo[3,4-d]pyrimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,6-dichloro-1-cyclopropylpyrazolo[5,4-d]pyrimidine (CAS 1628460-33-2) is a chemical compound with the molecular formula C8H6Cl2N4 and a molecular weight of 229.06 g/mol. IUPAC name: 4,6-dichloro-1-cyclopropylpyrazolo[5,4-d]pyrimidine. InChIKey: WISNHIHXVZGQHS-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2N4 |
|---|---|
| Molecular weight | 229.06 g/mol |
| IUPAC name | 4,6-dichloro-1-cyclopropylpyrazolo[5,4-d]pyrimidine |
| InChIKey | WISNHIHXVZGQHS-UHFFFAOYSA-N |
| SMILES | C1CC1N2C3=C(C=N2)C(=NC(=N3)Cl)Cl |
Computed by PubChem (NCBI)