CAS 168893-49-0 is the registry number for 5-(2,4-Dichlorophenyl)-4h-1,2,4-triazol-3-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
5-(2,4-dichlorophenyl)-1H-1,2,4-triazol-3-amine (CAS 168893-49-0) is a chemical compound with the molecular formula C8H6Cl2N4 and a molecular weight of 229.06 g/mol. IUPAC name: 5-(2,4-dichlorophenyl)-1H-1,2,4-triazol-3-amine. InChIKey: QJMITVPZPBGSTE-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2N4 |
|---|---|
| Molecular weight | 229.06 g/mol |
| IUPAC name | 5-(2,4-dichlorophenyl)-1H-1,2,4-triazol-3-amine |
| InChIKey | QJMITVPZPBGSTE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C2=NC(=NN2)N |
Computed by PubChem (NCBI)