Products 500692-39-7
CAS 500692-39-7 appears in our catalog under these names: 2，4–Dichloro–6，7–dimethylpteridine, 2,4-dichloro-6,7-dimethylpteridine, 97%+, 97%+, 2,4-Dichloro-6,7-dimethylpteridine, 97%+. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2,4-dichloro-6,7-dimethylpteridine (CAS 500692-39-7) is a chemical compound with the molecular formula C8H6Cl2N4 and a molecular weight of 229.06 g/mol. IUPAC name: 2,4-dichloro-6,7-dimethylpteridine. InChIKey: VJWDGZCTLXDUAK-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2N4 |
|---|---|
| Molecular weight | 229.06 g/mol |
| IUPAC name | 2,4-dichloro-6,7-dimethylpteridine |
| InChIKey | VJWDGZCTLXDUAK-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C2C(=N1)C(=NC(=N2)Cl)Cl)C |
Computed by PubChem (NCBI)