CAS 1248310-70-4 appears in our catalog under these names: 5-(2,6-Dichlorophenyl)-1,3-oxazole-4-carboxylic acid, 5-(2,6-Dichlorophenyl)-1,3-oxazole-4-carboxylic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 5g.
5-(2,6-dichlorophenyl)-1,3-oxazole-4-carboxylic acid (CAS 1248310-70-4) is a chemical compound with the molecular formula C10H5Cl2NO3 and a molecular weight of 258.05 g/mol. IUPAC name: 5-(2,6-dichlorophenyl)-1,3-oxazole-4-carboxylic acid. InChIKey: XJKZQXXYYHHNHB-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl2NO3 |
|---|---|
| Molecular weight | 258.05 g/mol |
| IUPAC name | 5-(2,6-dichlorophenyl)-1,3-oxazole-4-carboxylic acid |
| InChIKey | XJKZQXXYYHHNHB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C2=C(N=CO2)C(=O)O)Cl |
Computed by PubChem (NCBI)