Products 953724-37-3
CAS 953724-37-3 is the registry number for 5-(2,5-Dichlorophenyl)isoxazole-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2,5-dichlorophenyl)-1,2-oxazole-3-carboxylic acid (CAS 953724-37-3) is a chemical compound with the molecular formula C10H5Cl2NO3 and a molecular weight of 258.05 g/mol. IUPAC name: 5-(2,5-dichlorophenyl)-1,2-oxazole-3-carboxylic acid. InChIKey: SBWHRFWFVQARIB-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl2NO3 |
|---|---|
| Molecular weight | 258.05 g/mol |
| IUPAC name | 5-(2,5-dichlorophenyl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | SBWHRFWFVQARIB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C2=CC(=NO2)C(=O)O)Cl |
Computed by PubChem (NCBI)