CAS 951885-34-0 is the registry number for 5-(2,3-Dichlorophenyl)oxazole-4-carboxylic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
5-(2,3-dichlorophenyl)-1,3-oxazole-4-carboxylic acid (CAS 951885-34-0) is a chemical compound with the molecular formula C10H5Cl2NO3 and a molecular weight of 258.05 g/mol. IUPAC name: 5-(2,3-dichlorophenyl)-1,3-oxazole-4-carboxylic acid. InChIKey: UEDACSDCBQKSEN-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl2NO3 |
|---|---|
| Molecular weight | 258.05 g/mol |
| IUPAC name | 5-(2,3-dichlorophenyl)-1,3-oxazole-4-carboxylic acid |
| InChIKey | UEDACSDCBQKSEN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C2=C(N=CO2)C(=O)O |
Computed by PubChem (NCBI)