Products 951885-34-0

CAS 951885-34-0 is the registry number for 5-(2,3-Dichlorophenyl)oxazole-4-carboxylic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

5-(2,3-dichlorophenyl)-1,3-oxazole-4-carboxylic acid (CAS 951885-34-0) is a chemical compound with the molecular formula C10H5Cl2NO3 and a molecular weight of 258.05 g/mol. IUPAC name: 5-(2,3-dichlorophenyl)-1,3-oxazole-4-carboxylic acid. InChIKey: UEDACSDCBQKSEN-UHFFFAOYSA-N.

Identity
Molecular formulaC10H5Cl2NO3
Molecular weight258.05 g/mol
IUPAC name5-(2,3-dichlorophenyl)-1,3-oxazole-4-carboxylic acid
InChIKeyUEDACSDCBQKSEN-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)Cl)Cl)C2=C(N=CO2)C(=O)O

Computed by PubChem (NCBI)