CAS 876710-49-5 appears in our catalog under these names: 5-(3,4-Dichlorophenyl)isoxazole-3-carboxylic acid, 98%, 5-(3,4-Dichlorophenyl)isoxazole-3-carboxylic acid, 98%, 98%, 5-(3,4-Dichloro-phenyl)-isoxazole-3-carboxylic acid, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g, 25g.
5-(3,4-dichlorophenyl)-1,2-oxazole-3-carboxylic acid (CAS 876710-49-5) is a chemical compound with the molecular formula C10H5Cl2NO3 and a molecular weight of 258.05 g/mol. IUPAC name: 5-(3,4-dichlorophenyl)-1,2-oxazole-3-carboxylic acid. InChIKey: GJJPRTBPAZSUJZ-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl2NO3 |
|---|---|
| Molecular weight | 258.05 g/mol |
| IUPAC name | 5-(3,4-dichlorophenyl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | GJJPRTBPAZSUJZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC(=NO2)C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)