Products 134785-79-8

CAS 134785-79-8 is the registry number for 6,8-Dichloro-4-oxo-1,4-dihydroquinoline-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

6,8-dichloro-4-oxo-1H-quinoline-2-carboxylic acid (CAS 134785-79-8) is a chemical compound with the molecular formula C10H5Cl2NO3 and a molecular weight of 258.05 g/mol. IUPAC name: 6,8-dichloro-4-oxo-1H-quinoline-2-carboxylic acid. InChIKey: GCDMWZNNUSRHDI-UHFFFAOYSA-N.

Identity
Molecular formulaC10H5Cl2NO3
Molecular weight258.05 g/mol
IUPAC name6,8-dichloro-4-oxo-1H-quinoline-2-carboxylic acid
InChIKeyGCDMWZNNUSRHDI-UHFFFAOYSA-N
SMILESC1=C(C=C(C2=C1C(=O)C=C(N2)C(=O)O)Cl)Cl

Computed by PubChem (NCBI)