CAS 51726-82-0 appears in our catalog under these names: 6,7-Dichloro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid, 95%, 6,7-Dichloro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
6,7-dichloro-4-oxo-1H-quinoline-3-carboxylic acid (CAS 51726-82-0) is a chemical compound with the molecular formula C10H5Cl2NO3 and a molecular weight of 258.05 g/mol. IUPAC name: 6,7-dichloro-4-oxo-1H-quinoline-3-carboxylic acid. InChIKey: BFCGHXVOVSHPIC-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl2NO3 |
|---|---|
| Molecular weight | 258.05 g/mol |
| IUPAC name | 6,7-dichloro-4-oxo-1H-quinoline-3-carboxylic acid |
| InChIKey | BFCGHXVOVSHPIC-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Cl)Cl)NC=C(C2=O)C(=O)O |
Computed by PubChem (NCBI)