Products 712348-40-8
CAS 712348-40-8 appears in our catalog under these names: 5-(2,4-Dichlorophenyl)isoxazole-3-carboxylic acid, 95%, 5-(2,4-Dichlorophenyl)isoxazole-3-carboxylic acid, 98%, 5-(2,4-Dichlorophenyl)isoxazole-3-carboxylic acid, 98%, 98%, 5-(2,4-Dichloro-phenyl)-isoxazole-3-carboxylic acid. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 25g, 250mg.
5-(2,4-dichlorophenyl)-1,2-oxazole-3-carboxylic acid (CAS 712348-40-8) is a chemical compound with the molecular formula C10H5Cl2NO3 and a molecular weight of 258.05 g/mol. IUPAC name: 5-(2,4-dichlorophenyl)-1,2-oxazole-3-carboxylic acid. InChIKey: JTPPKCXDMFYTFD-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl2NO3 |
|---|---|
| Molecular weight | 258.05 g/mol |
| IUPAC name | 5-(2,4-dichlorophenyl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | JTPPKCXDMFYTFD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C2=CC(=NO2)C(=O)O |
Computed by PubChem (NCBI)