Products 1250810-15-1

CAS 1250810-15-1 is the registry number for 3-(3,5-Dichlorophenyl)-3-hydroxypropanoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

3-(3,5-dichlorophenyl)-3-hydroxypropanoic acid (CAS 1250810-15-1) is a chemical compound with the molecular formula C9H8Cl2O3 and a molecular weight of 235.06 g/mol. IUPAC name: 3-(3,5-dichlorophenyl)-3-hydroxypropanoic acid. InChIKey: UAOVLUFVXKIGKW-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8Cl2O3
Molecular weight235.06 g/mol
IUPAC name3-(3,5-dichlorophenyl)-3-hydroxypropanoic acid
InChIKeyUAOVLUFVXKIGKW-UHFFFAOYSA-N
SMILESC1=C(C=C(C=C1Cl)Cl)C(CC(=O)O)O

Computed by PubChem (NCBI)