CAS 125213-45-8 is the registry number for (2Z)-(3-oxo-2-Benzofuran-1(3H)-ylidene)ethanoic Acid. Offered by: TRC. Available pack sizes: 500mg.
(2Z)-2-(3-oxo-2-benzofuran-1-ylidene)acetic acid (CAS 125213-45-8) is a chemical compound with the molecular formula C10H6O4 and a molecular weight of 190.15 g/mol. IUPAC name: (2Z)-2-(3-oxo-2-benzofuran-1-ylidene)acetic acid. InChIKey: XKMGDVJBAWUUDZ-YVMONPNESA-N.
| Molecular formula | C10H6O4 |
|---|---|
| Molecular weight | 190.15 g/mol |
| IUPAC name | (2Z)-2-(3-oxo-2-benzofuran-1-ylidene)acetic acid |
| InChIKey | XKMGDVJBAWUUDZ-YVMONPNESA-N |
| SMILES | C1=CC=C2C(=C1)/C(=C/C(=O)O)/OC2=O |
Computed by PubChem (NCBI)