Products 1253912-00-3
CAS 1253912-00-3 appears in our catalog under these names: 2,3-Dimethyl-2h-indazol-6-ylboronic acid, 95%, (2,3-Dimethyl-2H-indazol-6-yl)boronic acid, 97%, (2，3-dimethyl-2H-indazol-6-yl)boronic acid, 97%, 97%, 2,3-DIMETHYL-2H-INDAZOLE-6-BORONIC ACID, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 100mg, 250mg, 500mg.
(2,3-dimethylindazol-6-yl)boronic acid (CAS 1253912-00-3) is a chemical compound with the molecular formula C9H11BN2O2 and a molecular weight of 190.01 g/mol. IUPAC name: (2,3-dimethylindazol-6-yl)boronic acid. InChIKey: FBEURACXBMNIJO-UHFFFAOYSA-N.
| Molecular formula | C9H11BN2O2 |
|---|---|
| Molecular weight | 190.01 g/mol |
| IUPAC name | (2,3-dimethylindazol-6-yl)boronic acid |
| InChIKey | FBEURACXBMNIJO-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=NN(C(=C2C=C1)C)C)(O)O |
Computed by PubChem (NCBI)