Products 2304634-35-1

CAS 2304634-35-1 is the registry number for 2,3-Dimethyl-2h-indazole-4-boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

(2,3-dimethylindazol-4-yl)boronic acid (CAS 2304634-35-1) is a chemical compound with the molecular formula C9H11BN2O2 and a molecular weight of 190.01 g/mol. IUPAC name: (2,3-dimethylindazol-4-yl)boronic acid. InChIKey: LGWXPYAIHHHIAJ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11BN2O2
Molecular weight190.01 g/mol
IUPAC name(2,3-dimethylindazol-4-yl)boronic acid
InChIKeyLGWXPYAIHHHIAJ-UHFFFAOYSA-N
SMILESB(C1=CC=CC2=NN(C(=C12)C)C)(O)O

Computed by PubChem (NCBI)