Products 2377609-65-7
CAS 2377609-65-7 is the registry number for 3-Cyano-4-(dimethylamino)phenylboronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
[3-cyano-4-(dimethylamino)phenyl]boronic acid (CAS 2377609-65-7) is a chemical compound with the molecular formula C9H11BN2O2 and a molecular weight of 190.01 g/mol. IUPAC name: [3-cyano-4-(dimethylamino)phenyl]boronic acid. InChIKey: SYQJXRPGAWLFGL-UHFFFAOYSA-N.
| Molecular formula | C9H11BN2O2 |
|---|---|
| Molecular weight | 190.01 g/mol |
| IUPAC name | [3-cyano-4-(dimethylamino)phenyl]boronic acid |
| InChIKey | SYQJXRPGAWLFGL-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)N(C)C)C#N)(O)O |
Computed by PubChem (NCBI)