CAS 1661043-48-6 appears in our catalog under these names: (1-Ethyl-1,3-benzodiazol-5-yl)boronic acid, 98%, (1-Ethyl-1H-benzo[d]imidazol-5-yl)boronic acid 98%, (1-Ethyl-1,3-benzodiazol-5-yl)boronic acid, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
(1-ethylbenzimidazol-5-yl)boronic acid (CAS 1661043-48-6) is a chemical compound with the molecular formula C9H11BN2O2 and a molecular weight of 190.01 g/mol. IUPAC name: (1-ethylbenzimidazol-5-yl)boronic acid. InChIKey: AKLWXFSUGCBRFR-UHFFFAOYSA-N.
| Molecular formula | C9H11BN2O2 |
|---|---|
| Molecular weight | 190.01 g/mol |
| IUPAC name | (1-ethylbenzimidazol-5-yl)boronic acid |
| InChIKey | AKLWXFSUGCBRFR-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)N(C=N2)CC)(O)O |
Computed by PubChem (NCBI)